CAS 792953-08-3 is the registry number for 5-Amino-1-(2-nitrophenyl)-1H-pyrazole-4-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-amino-1-(2-nitrophenyl)pyrazole-4-carboxamide (CAS 792953-08-3) is a chemical compound with the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. IUPAC name: 5-amino-1-(2-nitrophenyl)pyrazole-4-carboxamide. InChIKey: GZHBTVHPOBBMAU-UHFFFAOYSA-N.
| Molecular formula | C10H9N5O3 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 5-amino-1-(2-nitrophenyl)pyrazole-4-carboxamide |
| InChIKey | GZHBTVHPOBBMAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=C(C=N2)C(=O)N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)