CAS 793-43-1 appears in our catalog under these names: Phenol, 4-(diphenylphosphinyl)-, 95%+, 95%+, 4-DIPHENYLPHOSPHORYLPHENOL, 95%+. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-diphenylphosphorylphenol (CAS 793-43-1) is a chemical compound with the molecular formula C18H15O2P and a molecular weight of 294.3 g/mol. IUPAC name: 4-diphenylphosphorylphenol. InChIKey: QFUAZGOBONNJEI-UHFFFAOYSA-N.
| Molecular formula | C18H15O2P |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 4-diphenylphosphorylphenol |
| InChIKey | QFUAZGOBONNJEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)