CAS 79319-85-0 appears in our catalog under these names: Bismerthiazol, 95%, Bismerthiazol, Bismerthiazol 90%, BISMERTHIAZOL PESTANAL, 5,5'-(Methylenebis(azanediyl))bis(1,3,4-thiadiazole-2(3H)-thione), 90%, 90%. Offered by: Combi-blocks, Chemat, Ambeed, Sigma-Aldrich, HPC Standards. Available pack sizes: 1g, 5g, 25g, 10g, 100MG, 1x100mg.
5-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methylamino]-3H-1,3,4-thiadiazole-2-thione (CAS 79319-85-0) is a chemical compound with the molecular formula C5H6N6S4 and a molecular weight of 278.4 g/mol. IUPAC name: 5-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methylamino]-3H-1,3,4-thiadiazole-2-thione. InChIKey: RSNWORHVUOZYLT-UHFFFAOYSA-N.
| Molecular formula | C5H6N6S4 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 5-[[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)amino]methylamino]-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | RSNWORHVUOZYLT-UHFFFAOYSA-N |
| SMILES | C(NC1=NNC(=S)S1)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)