CAS 793713-92-5 appears in our catalog under these names: CHEMBL1380345/ 98.26% (existing batch purity), CHEMBL1380345, ≥90%, ≥90%, N,N'-(Ethane-1,2-diyl)bis(3-methylbenzenesulfonamide), 98%. Offered by: TargetMol, Chemat, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-methyl-N-[2-[(3-methylphenyl)sulfonylamino]ethyl]benzenesulfonamide (CAS 793713-92-5) is a chemical compound with the molecular formula C16H20N2O4S2 and a molecular weight of 368.5 g/mol. IUPAC name: 3-methyl-N-[2-[(3-methylphenyl)sulfonylamino]ethyl]benzenesulfonamide. InChIKey: PTKBYSSHVPWNBN-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O4S2 |
|---|---|
| Molecular weight | 368.5 g/mol |
| IUPAC name | 3-methyl-N-[2-[(3-methylphenyl)sulfonylamino]ethyl]benzenesulfonamide |
| InChIKey | PTKBYSSHVPWNBN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)S(=O)(=O)NCCNS(=O)(=O)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)