CAS 793716-08-2 is the registry number for 7-Chloro-3-(2,3-dimethylphenyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
7-chloro-3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 793716-08-2) is a chemical compound with the molecular formula C16H13ClN2OS and a molecular weight of 316.8 g/mol. IUPAC name: 7-chloro-3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: JEYOKZYQJOHZAA-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2OS |
|---|---|
| Molecular weight | 316.8 g/mol |
| IUPAC name | 7-chloro-3-(2,3-dimethylphenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | JEYOKZYQJOHZAA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N2C(=O)C3=C(C=C(C=C3)Cl)NC2=S)C |
Computed by PubChem (NCBI)