Products 793716-21-9

CAS 793716-21-9 is the registry number for 5-((Diphenylmethyl)sulfamoyl)-2-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-(benzhydrylsulfamoyl)-2-methylbenzoic acid (CAS 793716-21-9) is a chemical compound with the molecular formula C21H19NO4S and a molecular weight of 381.4 g/mol. IUPAC name: 5-(benzhydrylsulfamoyl)-2-methylbenzoic acid. InChIKey: ZBYCTOQAJCFYKH-UHFFFAOYSA-N.

Identity
Molecular formulaC21H19NO4S
Molecular weight381.4 g/mol
IUPAC name5-(benzhydrylsulfamoyl)-2-methylbenzoic acid
InChIKeyZBYCTOQAJCFYKH-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)S(=O)(=O)NC(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)