CAS 793716-21-9 is the registry number for 5-((Diphenylmethyl)sulfamoyl)-2-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-(benzhydrylsulfamoyl)-2-methylbenzoic acid (CAS 793716-21-9) is a chemical compound with the molecular formula C21H19NO4S and a molecular weight of 381.4 g/mol. IUPAC name: 5-(benzhydrylsulfamoyl)-2-methylbenzoic acid. InChIKey: ZBYCTOQAJCFYKH-UHFFFAOYSA-N.
| Molecular formula | C21H19NO4S |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | 5-(benzhydrylsulfamoyl)-2-methylbenzoic acid |
| InChIKey | ZBYCTOQAJCFYKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)