CAS 793727-51-2 is the registry number for 2-Chloro-N-(1-(2,4-difluorophenyl)ethyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-[1-(2,4-difluorophenyl)ethyl]acetamide (CAS 793727-51-2) is a chemical compound with the molecular formula C10H10ClF2NO and a molecular weight of 233.64 g/mol. IUPAC name: 2-chloro-N-[1-(2,4-difluorophenyl)ethyl]acetamide. InChIKey: BOFNYQXSXAJQLI-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF2NO |
|---|---|
| Molecular weight | 233.64 g/mol |
| IUPAC name | 2-chloro-N-[1-(2,4-difluorophenyl)ethyl]acetamide |
| InChIKey | BOFNYQXSXAJQLI-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)F)F)NC(=O)CCl |
Computed by PubChem (NCBI)