Products 793730-86-6
CAS 793730-86-6 is the registry number for N-Cyclopropyl-2-((2,5-dichlorophenyl)thio)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclopropyl-2-(2,5-dichlorophenyl)sulfanylacetamide (CAS 793730-86-6) is a chemical compound with the molecular formula C11H11Cl2NOS and a molecular weight of 276.2 g/mol. IUPAC name: N-cyclopropyl-2-(2,5-dichlorophenyl)sulfanylacetamide. InChIKey: IIUIZMAFAQGYGF-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NOS |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | N-cyclopropyl-2-(2,5-dichlorophenyl)sulfanylacetamide |
| InChIKey | IIUIZMAFAQGYGF-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)CSC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)