CAS 79387-14-7 is the registry number for 4-(Chloromethyl)-2-phenyl-1,3-thiazole hydrochloride. Offered by: Biosynth. Available pack sizes: 5g.
4-(chloromethyl)-2-phenyl-1,3-thiazole;hydrochloride (CAS 79387-14-7) is a chemical compound with the molecular formula C10H9Cl2NS and a molecular weight of 246.16 g/mol. IUPAC name: 4-(chloromethyl)-2-phenyl-1,3-thiazole;hydrochloride. InChIKey: ZDBDTEMHILGVRM-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NS |
|---|---|
| Molecular weight | 246.16 g/mol |
| IUPAC name | 4-(chloromethyl)-2-phenyl-1,3-thiazole;hydrochloride |
| InChIKey | ZDBDTEMHILGVRM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CCl.Cl |
Computed by PubChem (NCBI)