CAS 79407-66-2 is the registry number for 3-(2,4-Dihydroxyphenyl)-2-propenal. Offered by: TRC. Available pack sizes: 1g.
(E)-3-(2,4-dihydroxyphenyl)prop-2-enal (CAS 79407-66-2) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: (E)-3-(2,4-dihydroxyphenyl)prop-2-enal. InChIKey: JSWDOTNOMWCDJW-OWOJBTEDSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (E)-3-(2,4-dihydroxyphenyl)prop-2-enal |
| InChIKey | JSWDOTNOMWCDJW-OWOJBTEDSA-N |
| SMILES | C1=CC(=C(C=C1O)O)/C=C/C=O |
Computed by PubChem (NCBI)