CAS 794500-77-9 is the registry number for (3R,4R)-1-(tert-butyl)-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3R,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile (CAS 794500-77-9) is a chemical compound with the molecular formula C15H18F2N2 and a molecular weight of 264.31 g/mol. IUPAC name: (3R,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile. InChIKey: LSMMKNSKGIKZEZ-GXFFZTMASA-N.
| Molecular formula | C15H18F2N2 |
|---|---|
| Molecular weight | 264.31 g/mol |
| IUPAC name | (3R,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonitrile |
| InChIKey | LSMMKNSKGIKZEZ-GXFFZTMASA-N |
| SMILES | CC(C)(C)N1C[C@@H]([C@@H](C1)C2=C(C=C(C=C2)F)F)C#N |
Computed by PubChem (NCBI)