Products 794553-31-4
CAS 794553-31-4 is the registry number for WAY-638459, ≥96%, ≥96%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 100mg.
[1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (CAS 794553-31-4) is a chemical compound with the molecular formula C22H19N3O6 and a molecular weight of 421.4 g/mol. IUPAC name: [1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate. InChIKey: OMAOAUMYJAOSAZ-UHFFFAOYSA-N.
| Molecular formula | C22H19N3O6 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | [1-[(9-ethylcarbazol-3-yl)amino]-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| InChIKey | OMAOAUMYJAOSAZ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)NC(=O)C(C)OC(=O)C3=CC=C(O3)[N+](=O)[O-])C4=CC=CC=C41 |
Computed by PubChem (NCBI)