CAS 794574-17-7 is the registry number for N-(3-Cyanophenyl)-3-(1,3-dioxoisoindolin-2-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide (CAS 794574-17-7) is a chemical compound with the molecular formula C18H13N3O3 and a molecular weight of 319.3 g/mol. IUPAC name: N-(3-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide. InChIKey: OKUJICXVROWEQY-UHFFFAOYSA-N.
| Molecular formula | C18H13N3O3 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | N-(3-cyanophenyl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| InChIKey | OKUJICXVROWEQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=O)NC3=CC=CC(=C3)C#N |
Computed by PubChem (NCBI)