CAS 794584-39-7 is the registry number for 2-(4-(2-Nitrobenzenesulfonamido)phenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-[4-[(2-nitrophenyl)sulfonylamino]phenyl]acetic acid (CAS 794584-39-7) is a chemical compound with the molecular formula C14H12N2O6S and a molecular weight of 336.32 g/mol. IUPAC name: 2-[4-[(2-nitrophenyl)sulfonylamino]phenyl]acetic acid. InChIKey: WWVCWFIKHVIDDU-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O6S |
|---|---|
| Molecular weight | 336.32 g/mol |
| IUPAC name | 2-[4-[(2-nitrophenyl)sulfonylamino]phenyl]acetic acid |
| InChIKey | WWVCWFIKHVIDDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)NC2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)