Products 79467-19-9
CAS 79467-19-9 is the registry number for Sintropium (bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,5R)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-propylpentanoate bromide (CAS 79467-19-9) is a chemical compound with the molecular formula C19H36BrNO2 and a molecular weight of 390.4 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-propylpentanoate bromide. InChIKey: MOOADSDJJYWLMR-DGPRCEOPSA-M.
| Molecular formula | C19H36BrNO2 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-propylpentanoate bromide |
| InChIKey | MOOADSDJJYWLMR-DGPRCEOPSA-M |
| SMILES | CCCC(CCC)C(=O)OC1C[C@H]2CC[C@@H](C1)[N+]2(C)C(C)C.[Br-] |
Computed by PubChem (NCBI)