CAS 79491-46-6 appears in our catalog under these names: 2,6-Dibromo-3-methoxy-5-nitropyridine 97%, 2,6-Dibromo-3-methoxy-5-nitropyridine, 98%, 98%, 2,6-Dibromo-3-methoxy-5-nitropyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
2,6-dibromo-3-methoxy-5-nitropyridine (CAS 79491-46-6) is a chemical compound with the molecular formula C6H4Br2N2O3 and a molecular weight of 311.92 g/mol. IUPAC name: 2,6-dibromo-3-methoxy-5-nitropyridine. InChIKey: UHFLJHCYEBYJIT-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2N2O3 |
|---|---|
| Molecular weight | 311.92 g/mol |
| IUPAC name | 2,6-dibromo-3-methoxy-5-nitropyridine |
| InChIKey | UHFLJHCYEBYJIT-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C(=C1)[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)