CAS 79507-76-9 is the registry number for 2,2'-oxybis-1,1,1,3,3,3-hexafluoro-propane. Offered by: TRC. Available pack sizes: 1g.
1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propane (CAS 79507-76-9) is a chemical compound with the molecular formula C6H2F12O and a molecular weight of 318.06 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propane. InChIKey: CXJWJJZGJZNBRK-UHFFFAOYSA-N.
| Molecular formula | C6H2F12O |
|---|---|
| Molecular weight | 318.06 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propane |
| InChIKey | CXJWJJZGJZNBRK-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)