Products 795290-95-8
CAS 795290-95-8 appears in our catalog under these names: N-[4-(2-Amino-1,3-thiazol-4-yl)phenyl]-2,2-dimethylpropanamide, 95%, N-(4-(2-Amino-1,3-thiazol-4-yl)phenyl)-2,2-dimethylpropanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2-dimethylpropanamide (CAS 795290-95-8) is a chemical compound with the molecular formula C14H17N3OS and a molecular weight of 275.37 g/mol. IUPAC name: N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2-dimethylpropanamide. InChIKey: LSZIDHLVCNOFBH-UHFFFAOYSA-N.
| Molecular formula | C14H17N3OS |
|---|---|
| Molecular weight | 275.37 g/mol |
| IUPAC name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | LSZIDHLVCNOFBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)