CAS 795293-19-5 appears in our catalog under these names: 2-{(4-(4-methoxybenzenesulfonamido)phenyl)formamido}acetic acid, 95%, 2-{(4-(4-Methoxybenzenesulfonamido)phenyl)formamido}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
2-[[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]amino]acetic acid (CAS 795293-19-5) is a chemical compound with the molecular formula C16H16N2O6S and a molecular weight of 364.4 g/mol. IUPAC name: 2-[[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]amino]acetic acid. InChIKey: LLFFYSDZEXJNBT-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O6S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-[[4-[(4-methoxyphenyl)sulfonylamino]benzoyl]amino]acetic acid |
| InChIKey | LLFFYSDZEXJNBT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)