CAS 795307-83-4 is the registry number for tert-Butyl (3-Amino-5-(trifluoromethyl)phenyl)carbamate. Offered by: TRC. Available pack sizes: 500mg.
Tert-butyl N-[3-amino-5-(trifluoromethyl)phenyl]carbamate (CAS 795307-83-4) is a chemical compound with the molecular formula C12H15F3N2O2 and a molecular weight of 276.25 g/mol. IUPAC name: tert-butyl N-[3-amino-5-(trifluoromethyl)phenyl]carbamate. InChIKey: WMNCWFCSNVHPGF-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2O2 |
|---|---|
| Molecular weight | 276.25 g/mol |
| IUPAC name | tert-butyl N-[3-amino-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | WMNCWFCSNVHPGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)