CAS 79560-74-0 is the registry number for NSC73306. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
1-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-(4-methoxyphenyl)thiourea (CAS 79560-74-0) is a chemical compound with the molecular formula C16H12Cl2N4O2S and a molecular weight of 395.3 g/mol. IUPAC name: 1-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-(4-methoxyphenyl)thiourea. InChIKey: OJWGVIBWNCMAEK-UHFFFAOYSA-N.
| Molecular formula | C16H12Cl2N4O2S |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1-[(5,7-dichloro-2-hydroxy-1H-indol-3-yl)imino]-3-(4-methoxyphenyl)thiourea |
| InChIKey | OJWGVIBWNCMAEK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=S)N=NC2=C(NC3=C2C=C(C=C3Cl)Cl)O |
Computed by PubChem (NCBI)