CAS 79560-92-2 appears in our catalog under these names: Acetylcysteine Impurity 8, Acetylcysteine Impurity 4, Acetylcysteine Impurity 3, Acetylcysteine Impurity 11, Acetyl(sulfo)-D-alanine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(2R)-2-acetamido-3-sulfopropanoic acid (CAS 79560-92-2) is a chemical compound with the molecular formula C5H9NO6S and a molecular weight of 211.20 g/mol. IUPAC name: (2R)-2-acetamido-3-sulfopropanoic acid. InChIKey: JOOZPRJIUKWLDM-BYPYZUCNSA-N.
| Molecular formula | C5H9NO6S |
|---|---|
| Molecular weight | 211.20 g/mol |
| IUPAC name | (2R)-2-acetamido-3-sulfopropanoic acid |
| InChIKey | JOOZPRJIUKWLDM-BYPYZUCNSA-N |
| SMILES | CC(=O)N[C@@H](CS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)