Products 79583-94-1

CAS 79583-94-1 is the registry number for 2-Azidopropanoic acid, 0.5M solution in 2-methoxy-2-methylpropane. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-azidopropanoic acid (CAS 79583-94-1) is a chemical compound with the molecular formula C3H5N3O2 and a molecular weight of 115.09 g/mol. IUPAC name: 2-azidopropanoic acid. InChIKey: XVNBLPHVIQXLMS-UHFFFAOYSA-N.

Identity
Molecular formulaC3H5N3O2
Molecular weight115.09 g/mol
IUPAC name2-azidopropanoic acid
InChIKeyXVNBLPHVIQXLMS-UHFFFAOYSA-N
SMILESCC(C(=O)O)N=[N+]=[N-]

Computed by PubChem (NCBI)