CAS 796-69-0 is the registry number for Bis(4-fluoro-2-nitrophenyl) disulfide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-fluoro-1-[(4-fluoro-2-nitrophenyl)disulfanyl]-2-nitrobenzene (CAS 796-69-0) is a chemical compound with the molecular formula C12H6F2N2O4S2 and a molecular weight of 344.3 g/mol. IUPAC name: 4-fluoro-1-[(4-fluoro-2-nitrophenyl)disulfanyl]-2-nitrobenzene. InChIKey: ILHDUSONWGHVPO-UHFFFAOYSA-N.
| Molecular formula | C12H6F2N2O4S2 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 4-fluoro-1-[(4-fluoro-2-nitrophenyl)disulfanyl]-2-nitrobenzene |
| InChIKey | ILHDUSONWGHVPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])SSC2=C(C=C(C=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)