CAS 796038-73-8 is the registry number for (R)-2-Methyl-n-(4-methylbenzylidene)propane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(R)-2-methyl-N-[(4-methylphenyl)methylidene]propane-2-sulfinamide (CAS 796038-73-8) is a chemical compound with the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. IUPAC name: (R)-2-methyl-N-[(4-methylphenyl)methylidene]propane-2-sulfinamide. InChIKey: CIQHJZHMIYCJTP-OAHLLOKOSA-N.
| Molecular formula | C12H17NOS |
|---|---|
| Molecular weight | 223.34 g/mol |
| IUPAC name | (R)-2-methyl-N-[(4-methylphenyl)methylidene]propane-2-sulfinamide |
| InChIKey | CIQHJZHMIYCJTP-OAHLLOKOSA-N |
| SMILES | CC1=CC=C(C=C1)C=N[S@](=O)C(C)(C)C |
Computed by PubChem (NCBI)