CAS 79606-47-6 appears in our catalog under these names: N,N-Di(propan-2-yl)-4-(trifluoromethyl)benzamide, 97%, N,N-di(propan-2-yl)-4-(trifluoromethyl)benzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
N,N-di(propan-2-yl)-4-(trifluoromethyl)benzamide (CAS 79606-47-6) is a chemical compound with the molecular formula C14H18F3NO and a molecular weight of 273.29 g/mol. IUPAC name: N,N-di(propan-2-yl)-4-(trifluoromethyl)benzamide. InChIKey: JIQMCMRDLLYYJY-UHFFFAOYSA-N.
| Molecular formula | C14H18F3NO |
|---|---|
| Molecular weight | 273.29 g/mol |
| IUPAC name | N,N-di(propan-2-yl)-4-(trifluoromethyl)benzamide |
| InChIKey | JIQMCMRDLLYYJY-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)