CAS 796065-15-1 appears in our catalog under these names: 3-{(4-(4-Ethoxybenzenesulfonamido)phenyl)formamido}propanoic acid, 3-(4-(4-Ethoxyphenylsulfonamido)benzamido)propanoic acid, 95%, 95%, 3-{[4-(4-ethoxybenzenesulfonamido)phenyl]formamido}propanoic acid, 95%, 3-(4-(4-Ethoxyphenylsulfonamido)benzamido)propanoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.
3-[[4-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]propanoic acid (CAS 796065-15-1) is a chemical compound with the molecular formula C18H20N2O6S and a molecular weight of 392.4 g/mol. IUPAC name: 3-[[4-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]propanoic acid. InChIKey: MUEAZTNLRXDROO-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O6S |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 3-[[4-[(4-ethoxyphenyl)sulfonylamino]benzoyl]amino]propanoic acid |
| InChIKey | MUEAZTNLRXDROO-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)