CAS 796072-24-7 is the registry number for (4-(Dibenzo[b,d]furan-4-yl)phenyl)trimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-dibenzofuran-4-ylphenyl)-trimethylsilane (CAS 796072-24-7) is a chemical compound with the molecular formula C21H20OSi and a molecular weight of 316.5 g/mol. IUPAC name: (4-dibenzofuran-4-ylphenyl)-trimethylsilane. InChIKey: MJTCHPBNQSYPAH-UHFFFAOYSA-N.
| Molecular formula | C21H20OSi |
|---|---|
| Molecular weight | 316.5 g/mol |
| IUPAC name | (4-dibenzofuran-4-ylphenyl)-trimethylsilane |
| InChIKey | MJTCHPBNQSYPAH-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=C(C=C1)C2=CC=CC3=C2OC4=CC=CC=C34 |
Computed by PubChem (NCBI)