Products 79611-43-1
CAS 79611-43-1 is the registry number for Sulbactam Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R,6R)-6-bromo-3,3-dimethyl-4,7-dioxo-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 79611-43-1) is a chemical compound with the molecular formula C8H10BrNO4S and a molecular weight of 296.14 g/mol. IUPAC name: (2S,5R,6R)-6-bromo-3,3-dimethyl-4,7-dioxo-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: LNXWCZHUJOCCBY-KWBRGLTQSA-N.
| Molecular formula | C8H10BrNO4S |
|---|---|
| Molecular weight | 296.14 g/mol |
| IUPAC name | (2S,5R,6R)-6-bromo-3,3-dimethyl-4,7-dioxo-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | LNXWCZHUJOCCBY-KWBRGLTQSA-N |
| SMILES | CC1([C@@H](N2[C@H](S1=O)[C@@H](C2=O)Br)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Sulbactam Impurity 10