CAS 79614-91-8 appears in our catalog under these names: Fluazinam Impurity 2, Deschloro Methoxy Fluazinam. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-chloro-N-[3-methoxy-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine (CAS 79614-91-8) is a chemical compound with the molecular formula C14H7ClF6N4O5 and a molecular weight of 460.67 g/mol. IUPAC name: 3-chloro-N-[3-methoxy-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine. InChIKey: VPAHINIMIAFMMR-UHFFFAOYSA-N.
| Molecular formula | C14H7ClF6N4O5 |
|---|---|
| Molecular weight | 460.67 g/mol |
| IUPAC name | 3-chloro-N-[3-methoxy-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine |
| InChIKey | VPAHINIMIAFMMR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1C(F)(F)F)[N+](=O)[O-])NC2=C(C=C(C=N2)C(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)