CAS 79622-11-0 appears in our catalog under these names: Alpha-methoxy-omega-(4-methylbenzenesulfonate) hepta(ethylene glycol), 95%, m–PEG7–Tos, Alpha-methoxy-omega-(4-methylbenzenesulfonate) hepta(ethylene glycol), 98%, 98%, m-PEG7-Tos, m-PEG7-Tos, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5 mg, 10 mg, 100 mg, 25 mg, 50 mg.
2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 79622-11-0) is a chemical compound with the molecular formula C22H38O10S and a molecular weight of 494.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: ZTSLDMCZJSLHRN-UHFFFAOYSA-N.
| Molecular formula | C22H38O10S |
|---|---|
| Molecular weight | 494.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | ZTSLDMCZJSLHRN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOC |
Computed by PubChem (NCBI)