CAS 79677-58-0 appears in our catalog under these names: 3-Iodo-L-tyrosine methyl ester hydrochloride, 98%, (S)-Methyl 2-amino-3-(4-hydroxy-3-iodophenyl)propanoate hydrochloride, 98%, 3-Iodo-L-tyrosine methyl ester hydrochloride, 98%, 98%, (S)-METHYL 2-AMINO-3-(4-HYDROXY-3-IODOPHENYL)PROPANOATE HCL, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate;hydrochloride (CAS 79677-58-0) is a chemical compound with the molecular formula C10H13ClINO3 and a molecular weight of 357.57 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate;hydrochloride. InChIKey: CCYPOKVFIQWUNE-QRPNPIFTSA-N.
| Molecular formula | C10H13ClINO3 |
|---|---|
| Molecular weight | 357.57 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate;hydrochloride |
| InChIKey | CCYPOKVFIQWUNE-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=C(C=C1)O)I)N.Cl |
Computed by PubChem (NCBI)