CAS 796844-14-9 is the registry number for 4-((2,4-Bis(trifluoromethyl)benzyl)oxy)-3-methoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxybenzaldehyde (CAS 796844-14-9) is a chemical compound with the molecular formula C17H12F6O3 and a molecular weight of 378.26 g/mol. IUPAC name: 4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxybenzaldehyde. InChIKey: ANYANJXMVRWDHQ-UHFFFAOYSA-N.
| Molecular formula | C17H12F6O3 |
|---|---|
| Molecular weight | 378.26 g/mol |
| IUPAC name | 4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxybenzaldehyde |
| InChIKey | ANYANJXMVRWDHQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OCC2=C(C=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)