CAS 797-70-6 appears in our catalog under these names: Tris(4-methylphenyl)phosphine oxide, 98%, Tris(4–methylphenyl)phosphine Oxide, Tris(4-methylphenyl)phosphine Oxide, >98.0%(GC), Tri-p-tolylphosphine oxide 98%, Tri-p-tolylphosphine oxide, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 100g, 250mg, 25g.
1-bis(4-methylphenyl)phosphoryl-4-methylbenzene (CAS 797-70-6) is a chemical compound with the molecular formula C21H21OP and a molecular weight of 320.4 g/mol. IUPAC name: 1-bis(4-methylphenyl)phosphoryl-4-methylbenzene. InChIKey: SPKBYIYIZQARNX-UHFFFAOYSA-N.
| Molecular formula | C21H21OP |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 1-bis(4-methylphenyl)phosphoryl-4-methylbenzene |
| InChIKey | SPKBYIYIZQARNX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)P(=O)(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)