Products 79741-17-6

CAS 79741-17-6 is the registry number for 6-(3-(Pyridin-2-yldisulfaneyl)propanamido)hexanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid (CAS 79741-17-6) is a chemical compound with the molecular formula C14H20N2O3S2 and a molecular weight of 328.5 g/mol. IUPAC name: 6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid. InChIKey: KPFOKUHANTWLRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20N2O3S2
Molecular weight328.5 g/mol
IUPAC name6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid
InChIKeyKPFOKUHANTWLRQ-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)SSCCC(=O)NCCCCCC(=O)O

Computed by PubChem (NCBI)