Products 79750-20-2

CAS 79750-20-2 is the registry number for 2-[(1-Adamantylmethyl)amino]ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(1-adamantylmethylamino)ethanol;hydrochloride (CAS 79750-20-2) is a chemical compound with the molecular formula C13H24ClNO and a molecular weight of 245.79 g/mol. IUPAC name: 2-(1-adamantylmethylamino)ethanol;hydrochloride. InChIKey: CVXQEKSOBOLQLH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24ClNO
Molecular weight245.79 g/mol
IUPAC name2-(1-adamantylmethylamino)ethanol;hydrochloride
InChIKeyCVXQEKSOBOLQLH-UHFFFAOYSA-N
SMILESC1C2CC3CC1CC(C2)(C3)CNCCO.Cl

Computed by PubChem (NCBI)