CAS 79775-07-8 appears in our catalog under these names: H–Hyp(tBu)–OH, H-Hyp(tBu)-OH, 97%, 97%, H-Hyp(tBu)-OH, 97.0%, H-Hyp(tBu)-OH, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 500g, 250mg, 1g, 100g, 10 g.
(2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid (CAS 79775-07-8) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid. InChIKey: XTQZONYRNXFGCY-RQJHMYQMSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (2S,4R)-4-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid |
| InChIKey | XTQZONYRNXFGCY-RQJHMYQMSA-N |
| SMILES | CC(C)(C)O[C@@H]1C[C@H](NC1)C(=O)O |
Computed by PubChem (NCBI)