Products 79814-40-7
CAS 79814-40-7 appears in our catalog under these names: (+)–O–Acetyl–D–malic Anhydride, (R)-2,5-Dioxotetrahydrofuran-3-yl acetate 97%, (R)-2,5-Dioxotetrahydrofuran-3-yl acetate, 97%, 97%, (R)-2,5-Dioxotetrahydrofuran-3-yl acetate, 98.0%, (R)-2,5-Dioxotetrahydrofuran-3-yl acetate, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 250 mg, 1 g.
[(3R)-2,5-dioxooxolan-3-yl] acetate (CAS 79814-40-7) is a chemical compound with the molecular formula C6H6O5 and a molecular weight of 158.11 g/mol. IUPAC name: [(3R)-2,5-dioxooxolan-3-yl] acetate. InChIKey: SSWJHSASZZAIAU-SCSAIBSYSA-N.
| Molecular formula | C6H6O5 |
|---|---|
| Molecular weight | 158.11 g/mol |
| IUPAC name | [(3R)-2,5-dioxooxolan-3-yl] acetate |
| InChIKey | SSWJHSASZZAIAU-SCSAIBSYSA-N |
| SMILES | CC(=O)O[C@@H]1CC(=O)OC1=O |
Computed by PubChem (NCBI)
Synonyms:
(+)-O-Acetyl-D-malic Anhydride, (3R)-3-(Acetyloxy)dihydro-2,5-furandione, (R)-(+)-2-Acetoxysuccinic anhydride, (R)-2,5-dioxotetrahydrofuran-3-yl acetate, (R)-2-O-Acetylmalic Anhydride, [(3R)-2,5-dioxooxolan-3-yl] acetate, 2,5-Furandione, 3-(acetyloxy)dihydro-, (R)-, (R)-(+)-2-Acetoxysuccinic anhydride, 96%, (R)-2,5-dioxotetrahy, orb3144112