CAS 79850-12-7 appears in our catalog under these names: 1,3-Bis(trifluoromethyl)cyclohexane, 95%, 1,3–Bis(trifluoromethyl)cyclohexane (cis– and trans– mixture), 1,3-Bis(trifluoromethyl)cyclohexane (cis- and trans- mixture), >98.0%(GC), 1,3-Bis(trifluoromethyl)cyclohexane (cis- and trans- mixture). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 200mg.
1,3-bis(trifluoromethyl)cyclohexane (CAS 79850-12-7) is a chemical compound with the molecular formula C8H10F6 and a molecular weight of 220.15 g/mol. IUPAC name: 1,3-bis(trifluoromethyl)cyclohexane. InChIKey: XIJLJFDFDZSWDG-UHFFFAOYSA-N.
| Molecular formula | C8H10F6 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 1,3-bis(trifluoromethyl)cyclohexane |
| InChIKey | XIJLJFDFDZSWDG-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)