Products 79851-29-9
CAS 79851-29-9 appears in our catalog under these names: Ethyl perfluoro(2-methyl-3-oxahexanoate), 95%, Ethyl perfluoro(2-methyl-3-oxahexanoate). Offered by: Combi-blocks, HPC Standards. Available pack sizes: 25g, 5g, 1g, 1x10mg.
Ethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (CAS 79851-29-9) is a chemical compound with the molecular formula C8H5F11O3 and a molecular weight of 358.11 g/mol. IUPAC name: ethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate. InChIKey: HJLWKGDZOZTKIS-UHFFFAOYSA-N.
| Molecular formula | C8H5F11O3 |
|---|---|
| Molecular weight | 358.11 g/mol |
| IUPAC name | ethyl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| InChIKey | HJLWKGDZOZTKIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)