CAS 798558-44-8 is the registry number for (3,4-diphenyl(2,5-thiazolyl))-2-pyridylamine, hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg.
4,5-diphenyl-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride (CAS 798558-44-8) is a chemical compound with the molecular formula C20H16ClN3S and a molecular weight of 365.9 g/mol. IUPAC name: 4,5-diphenyl-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride. InChIKey: XYGLTMSXXDLFRR-UHFFFAOYSA-N.
| Molecular formula | C20H16ClN3S |
|---|---|
| Molecular weight | 365.9 g/mol |
| IUPAC name | 4,5-diphenyl-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | XYGLTMSXXDLFRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)NC3=CC=CC=N3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)