CAS 79917-90-1 appears in our catalog under these names: 1–Butyl–3–methylimidazolium chloride, 1-Butyl-3-methylimidazolium chloride, 1-BUTYL-3-METHYLIMIDAZOLIUM CHLORIDE, >&, 1-Butyl-3-methylimidazolium chloride, 99.00%, 1-Butyl-3-methylimidazolium chloride, 98+%. Offered by: GLPBio, Biosynth, Sigma-Aldrich, Chemat, Thermo Scientific (Acros). Available pack sizes: 500g, 10g, 25g, 50g, 100g, 250g, 5G, 1g.
1-butyl-3-methylimidazol-3-ium chloride (CAS 79917-90-1) is a chemical compound with the molecular formula C8H15ClN2 and a molecular weight of 174.67 g/mol. IUPAC name: 1-butyl-3-methylimidazol-3-ium chloride. InChIKey: FHDQNOXQSTVAIC-UHFFFAOYSA-M.
| Molecular formula | C8H15ClN2 |
|---|---|
| Molecular weight | 174.67 g/mol |
| IUPAC name | 1-butyl-3-methylimidazol-3-ium chloride |
| InChIKey | FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| SMILES | CCCCN1C=C[N+](=C1)C.[Cl-] |
Computed by PubChem (NCBI)