CAS 79925-38-5 appears in our catalog under these names: Felodipine EP Impurity C, Felodipine Impurity 3(Felodipine EP Impurity C), Nemadipine B, >95% (HPLC), Diethyl 4-(2,3-Dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, Nemadipine B. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 4x25mg.
Diethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 79925-38-5) is a chemical compound with the molecular formula C19H21Cl2NO4 and a molecular weight of 398.3 g/mol. IUPAC name: diethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: BLLWOXSSRQPDAT-UHFFFAOYSA-N.
| Molecular formula | C19H21Cl2NO4 |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | diethyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | BLLWOXSSRQPDAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OCC)C)C |
Computed by PubChem (NCBI)