CAS 79992-76-0 appears in our catalog under these names: 2-Ethylbutyric acid magnesium salt, 98%, Magnesium(II) 2–Ethylbutyrate, Magnesium 2-Ethylbutyrate, 98% (contains =<6%H2O), 98% (contains =<6%H2O), Magnesium(II) 2-Ethylbutyrate, 98%, Magnesium(II) 2-Ethylbutyrate, 98% (contains =<6%H2O). Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
Magnesium bis(2-ethylbutanoate) (CAS 79992-76-0) is a chemical compound with the molecular formula C12H22MgO4 and a molecular weight of 254.61 g/mol. IUPAC name: magnesium bis(2-ethylbutanoate). InChIKey: JOADGALWHMAAKM-UHFFFAOYSA-L.
| Molecular formula | C12H22MgO4 |
|---|---|
| Molecular weight | 254.61 g/mol |
| IUPAC name | magnesium bis(2-ethylbutanoate) |
| InChIKey | JOADGALWHMAAKM-UHFFFAOYSA-L |
| SMILES | CCC(CC)C(=O)[O-].CCC(CC)C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)