CAS 80-51-3 appears in our catalog under these names: 4,4'-Oxydibenzenesulfonyl Hydrazide, 4,4'-Oxybis(benzenesulfonylhydrazid). Offered by: TRC, HPC Standards. Available pack sizes: 10g, 1g, 5g, 1x1g.
4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide (CAS 80-51-3) is a chemical compound with the molecular formula C12H14N4O5S2 and a molecular weight of 358.4 g/mol. IUPAC name: 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide. InChIKey: NBOCQTNZUPTTEI-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O5S2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 4-[4-(hydrazinesulfonyl)phenoxy]benzenesulfonohydrazide |
| InChIKey | NBOCQTNZUPTTEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC=C(C=C2)S(=O)(=O)NN)S(=O)(=O)NN |
Computed by PubChem (NCBI)