CAS 80-81-9 is the registry number for 6-Ethyl-1,2,3,4-tetrahydro-1,1,4,4-tetramethylnaphthalene. Offered by: TRC. Available pack sizes: 50mg.
6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CAS 80-81-9) is a chemical compound with the molecular formula C16H24 and a molecular weight of 216.36 g/mol. IUPAC name: 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene. InChIKey: SLIOAQVQWDNBNB-UHFFFAOYSA-N.
| Molecular formula | C16H24 |
|---|---|
| Molecular weight | 216.36 g/mol |
| IUPAC name | 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| InChIKey | SLIOAQVQWDNBNB-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)