CAS 80-82-0 appears in our catalog under these names: 2-Nitrobenzenesulfonic acid, 95%, 2-Nitrobenzenesulfonic Acid, >98.0%(HPLC)(T), 2-Nitrobenzenesulfonic Acid Hydrate. Offered by: Combi-blocks, TCI, Biosynth. Available pack sizes: 1g, 5g, 25g.
2-nitrobenzenesulfonic acid (CAS 80-82-0) is a chemical compound with the molecular formula C6H5NO5S and a molecular weight of 203.17 g/mol. IUPAC name: 2-nitrobenzenesulfonic acid. InChIKey: HWTDMFJYBAURQR-UHFFFAOYSA-N.
| Molecular formula | C6H5NO5S |
|---|---|
| Molecular weight | 203.17 g/mol |
| IUPAC name | 2-nitrobenzenesulfonic acid |
| InChIKey | HWTDMFJYBAURQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])S(=O)(=O)O |
Computed by PubChem (NCBI)