CAS 80048-65-3 is the registry number for Dimethyltin dichloride-d6. Offered by: TRC. Available pack sizes: 25mg.
Dichloro-bis(trideuteriomethyl)stannane (CAS 80048-65-3) is a chemical compound with the molecular formula C2H6Cl2Sn and a molecular weight of 225.72 g/mol. IUPAC name: dichloro-bis(trideuteriomethyl)stannane. InChIKey: PKKGKUDPKRTKLJ-QLKZDHSDSA-L.
| Molecular formula | C2H6Cl2Sn |
|---|---|
| Molecular weight | 225.72 g/mol |
| IUPAC name | dichloro-bis(trideuteriomethyl)stannane |
| InChIKey | PKKGKUDPKRTKLJ-QLKZDHSDSA-L |
| SMILES | [2H]C([2H])([2H])[Sn](C([2H])([2H])[2H])(Cl)Cl |
Computed by PubChem (NCBI)