CAS 80051-04-3 appears in our catalog under these names: (R)–1–(3–Chlorophenyl)–1,2–ethanediol, (R)-1-(3-Chlorophenyl)-1,2-ethanediol, 95%, (R)-1-(3-Chlorophenyl)-1,2-ethanediol, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
(1R)-1-(3-chlorophenyl)ethane-1,2-diol (CAS 80051-04-3) is a chemical compound with the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. IUPAC name: (1R)-1-(3-chlorophenyl)ethane-1,2-diol. InChIKey: WLWZAZBRGPMXCW-QMMMGPOBSA-N.
| Molecular formula | C8H9ClO2 |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | (1R)-1-(3-chlorophenyl)ethane-1,2-diol |
| InChIKey | WLWZAZBRGPMXCW-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CO)O |
Computed by PubChem (NCBI)