CAS 80058-84-0 appears in our catalog under these names: 4-Bromo-2,6-diisopropylaniline, >95% (HPLC), 4–Bromo–2,6–diisopropylaniline, 4-Bromo-2,6-diisopropylaniline, >98.0%(T), 4-Bromo-2,6-diisopropylaniline 98%, 4-Bromo-2,6-diisopropylaniline, 98%, 98%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 2,5g, 5g, 100g, 25g, 1g, 500g, 50g.
4-bromo-2,6-di(propan-2-yl)aniline (CAS 80058-84-0) is a chemical compound with the molecular formula C12H18BrN and a molecular weight of 256.18 g/mol. IUPAC name: 4-bromo-2,6-di(propan-2-yl)aniline. InChIKey: QAQRHTYPYQPBSX-UHFFFAOYSA-N.
| Molecular formula | C12H18BrN |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 4-bromo-2,6-di(propan-2-yl)aniline |
| InChIKey | QAQRHTYPYQPBSX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)Br |
Computed by PubChem (NCBI)